191-24-2 Benzo[ghi]perylene
उत्पाद का नाम |
Benzo[ghi]perylene |
अंग्रेजी नाम |
Benzo[ghi]perylene; 1,12-Benzoperylene; Benzo[ghi]perylene (purity); benzo(g h i)perylene |
आणविक फार्मूला |
C22H12 |
आण्विक वजन |
276.3307 |
InChI |
InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
कैस रजिस्टी संख्या |
191-24-2 |
EINECS |
205-883-8 |
आणविक संरचना |
|
घनत्व |
1.378g/cm3 |
गलनांक |
276-280℃ |
उबलने का समय |
501°C at 760 mmHg |
अपवर्तक सूचकांक |
2.009 |
फ्लैश प्वाइंट |
247.2°C |
वाष्प का दबाव |
1.12E-09mmHg at 25°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R40:Possible risks of irreversible effects.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|